Boronic acid derivatives
eMolecules 850568-48-8 | 4-(3-Hydroxypropyl)phenylboronic acid | Combi-Blocks | MFCD04973734 | 180.010 | C9H13BO3 | 95.000 | OCCCc1ccc(cc1)B(O)O | 5g | 117520389
4-(3-Hydroxypropyl)phenylboronic acid | Combi-Blocks | 850568-48-8 | MFCD04973734 | 180.010 | C9H13BO3 | 95.000 | OCCCc1ccc(cc1)B(O)O | 5g | 117520389
Chem-Impex International, Inc. Cyclopentylboronic acid | MFCD01074541 | 5G
Cyclopentylboronic acid, MFCD01074541, 5G
eMolecules 1188405-87-9 | 1-Boc-4-pyrazoleboronic Acid | Accela ChemBio (ASD) | MFCD09951915 | 212.010 | C8H13BN2O4 | 95.000 | CC(C)(C)OC(=O)n1cc(cn1)B(O)O | 10g | 510406364
1-Boc-4-pyrazoleboronic Acid | Accela ChemBio (ASD) | 1188405-87-9 | MFCD09951915 | 212.010 | C8H13BN2O4 | 95.000 | CC(C)(C)OC(=O)n1cc(cn1)B(O)O | 10g | 510406364
eMolecules 883231-25-2 | (2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 1g | 507875991
(2-((tert-Butoxycarbonyl)amino)pyrimidin-5-yl)boronic acid | Synthonix - Stock | 883231-25-2 | MFCD16251533 | 239.040 | C9H14BN3O4 | 95.000 | CC(C)(C)OC(=O)Nc1ncc(cn1)B(O)O | 1g | 507875991
eMolecules 768-35-4 | (3-Fluorophenyl)boronic acid | Ambeed | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 25g | 552623003
(3-Fluorophenyl)boronic acid | Ambeed | 768-35-4 | MFCD00236042 | 139.920 | C6H6BFO2 | 98.000 | OB(O)c1cccc(F)c1 | 25g | 552623003
Cambridge Isotope Laboratories Dioxin Furan Food/Feed/QQQ Calibration Series (CS1-CS8) 8 x 0 25mL
Dioxin Furan Food/Feed/QQQ Calibration Series (CS1-CS8) 8 x 0 25mL
Medchemexpress LLC 2-Nitrophenylboronic acid | 5570-19-4 | 96036 | 166.93 | 10 G
2-Nitrophenylboronic acid is a versatile biochemical reagent and organic compound widely employed in various chemical synthesis applications. It is particularly recognized for its ability to form stable complexes with diols, making it a key reagent in organic synthesis. This compound also finds applications as a biological material and is utilized in the fields of medicine, pesticides, and electronic materials.
- Versatile biochemical reagent and organic compound
- Key reagent in organic synthesis
- Forms stable complexes with diols
- Used in medicine, pesticides, and electronic materials
Cambridge Isotope Laboratories Modified JIS Dioxin Furan Calibration Solution (CS7H) 0 2 mL
Modified JIS Dioxin Furan Calibration Solution (CS7H) 0 2 mL
eMolecules 1164100-84-8 | 2-Cyano-3-methoxyphenylboronic acid | Combi-Blocks | MFCD10696671 | 176.970 | C8H8BNO3 | 95.000 | COc1cccc(B(O)O)c1C#N | 1g | 117529491
2-Cyano-3-methoxyphenylboronic acid | Combi-Blocks | 1164100-84-8 | MFCD10696671 | 176.970 | C8H8BNO3 | 95.000 | COc1cccc(B(O)O)c1C#N | 1g | 117529491
Chemscene ChemScene | 4-(N-Methylaminocarbonyl)phenylboronic acid | 5G | CS-W022019 | 0.98 | 121177-82-0| MFCD03788427 | 178.98
ChemScene | 4-(N-Methylaminocarbonyl)phenylboronic acid | 5G | CS-W022019 | 0.98 | 121177-82-0| MFCD03788427 | 178.98
Cayman Chemical 9OxoOTrE Fatty Acids and Deriv
9-OxoOTrE is produced by the oxidation of 9-HpOTrE.{14394} 9-OxoOTrE exhibits antimicrobial activity against plant pathogenic microorganisms including bacteria and fungi.{14395}